C16H22N4OS — CID 119449181
N-(2-piperazin-1-ylethyl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide (PubChem CID 119449181) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is N-(2-piperazin-1-ylethyl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | N-(2-piperazin-1-ylethyl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 119449181 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-(2-piperazin-1-ylethyl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide |
| SMILES | O=C(NCCN1CCNCC1)c1cccn1Cc1cccs1 |
| InChI | InChI=1S/C16H22N4OS/c21-16(18-7-11-19-9-5-17-6-10-19)15-4-1-8-20(15)13-14-3-2-12-22-14/h1-4,8,12,17H,5-7,9-11,13H2,(H,18,21) |
| InChIKey | AOGISNGLOZBVHJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |