C16H23ClN4OS — CID 119449180
N-(2-piperazin-1-ylethyl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide;hydrochloride (PubChem CID 119449180) has the molecular formula C16H23ClN4OS and a molecular weight of 354.91 g/mol. Its IUPAC name is N-(2-piperazin-1-ylethyl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-(2-piperazin-1-ylethyl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119449180 |
| Molecular Formula | C16H23ClN4OS |
| Molecular Weight | 354.91 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-(2-piperazin-1-ylethyl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCN1CCNCC1)c1cccn1Cc1cccs1 |
| InChI | InChI=1S/C16H22N4OS.ClH/c21-16(18-7-11-19-9-5-17-6-10-19)15-4-1-8-20(15)13-14-3-2-12-22-14;/h1-4,8,12,17H,5-7,9-11,13H2,(H,18,21);1H |
| InChIKey | ADONWZAPJZKFPX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.91 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |