C11H20N2S — CID 65379566
2-N-(thiophen-2-ylmethyl)hexane-1,2-diamine (PubChem CID 65379566) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is 2-N-(thiophen-2-ylmethyl)hexane-1,2-diamine.
| Compound Name | 2-N-(thiophen-2-ylmethyl)hexane-1,2-diamine |
|---|---|
| PubChem CID | 65379566 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-N-(thiophen-2-ylmethyl)hexane-1,2-diamine |
| SMILES | CCCCC(CN)NCc1cccs1 |
| InChI | InChI=1S/C11H20N2S/c1-2-3-5-10(8-12)13-9-11-6-4-7-14-11/h4,6-7,10,13H,2-3,5,8-9,12H2,1H3 |
| InChIKey | QHYDEAJRPGFAKN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |