C13H21NS — CID 115706740
N-(thiophen-2-ylmethyl)oct-7-en-4-amine (PubChem CID 115706740) has the molecular formula C13H21NS and a molecular weight of 223.39 g/mol. Its IUPAC name is N-(thiophen-2-ylmethyl)oct-7-en-4-amine.
| Compound Name | N-(thiophen-2-ylmethyl)oct-7-en-4-amine |
|---|---|
| PubChem CID | 115706740 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.39 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-(thiophen-2-ylmethyl)oct-7-en-4-amine |
| SMILES | C=CCCC(CCC)NCc1cccs1 |
| InChI | InChI=1S/C13H21NS/c1-3-5-8-12(7-4-2)14-11-13-9-6-10-15-13/h3,6,9-10,12,14H,1,4-5,7-8,11H2,2H3 |
| InChIKey | XJXJKMLIPDZWOI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|