C14H25NS — CID 115641765
2,2,5-trimethyl-N-(thiophen-2-ylmethyl)hexan-3-amine (PubChem CID 115641765) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is 2,2,5-trimethyl-N-(thiophen-2-ylmethyl)hexan-3-amine.
| Compound Name | 2,2,5-trimethyl-N-(thiophen-2-ylmethyl)hexan-3-amine |
|---|---|
| PubChem CID | 115641765 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 2,2,5-trimethyl-N-(thiophen-2-ylmethyl)hexan-3-amine |
| SMILES | CC(C)CC(NCc1cccs1)C(C)(C)C |
| InChI | InChI=1S/C14H25NS/c1-11(2)9-13(14(3,4)5)15-10-12-7-6-8-16-12/h6-8,11,13,15H,9-10H2,1-5H3 |
| InChIKey | MCSGPSANBPOZPC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |