C11H19NS — CID 28669346
(2R,3S)-3-methyl-N-(thiophen-2-ylmethyl)pentan-2-amine (PubChem CID 28669346) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is (2R,3S)-3-methyl-N-(thiophen-2-ylmethyl)pentan-2-amine.
| Compound Name | (2R,3S)-3-methyl-N-(thiophen-2-ylmethyl)pentan-2-amine |
|---|---|
| PubChem CID | 28669346 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (2R,3S)-3-methyl-N-(thiophen-2-ylmethyl)pentan-2-amine |
| SMILES | CC[C@H](C)[C@@H](C)NCc1cccs1 |
| InChI | InChI=1S/C11H19NS/c1-4-9(2)10(3)12-8-11-6-5-7-13-11/h5-7,9-10,12H,4,8H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | GEEVXMUBNLQHLD-VHSXEESVSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |