C14H17NOS — CID 10220540
(1S,2R)-1-phenyl-2-(thiophen-2-ylmethylamino)propan-1-ol (PubChem CID 10220540) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is (1S,2R)-1-phenyl-2-(thiophen-2-ylmethylamino)propan-1-ol.
| Compound Name | (1S,2R)-1-phenyl-2-(thiophen-2-ylmethylamino)propan-1-ol |
|---|---|
| PubChem CID | 10220540 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (1S,2R)-1-phenyl-2-(thiophen-2-ylmethylamino)propan-1-ol |
| SMILES | C[C@@H](NCc1cccs1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H17NOS/c1-11(15-10-13-8-5-9-17-13)14(16)12-6-3-2-4-7-12/h2-9,11,14-16H,10H2,1H3/t11-,14-/m1/s1 |
| InChIKey | VUBUIPNYRJGLNP-BXUZGUMPSA-N |
| XLogP | 2.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |