C13H14O2S — CID 103459541
1-phenyl-3-thiophen-2-ylpropane-1,2-diol (PubChem CID 103459541) has the molecular formula C13H14O2S and a molecular weight of 234.32 g/mol. Its IUPAC name is 1-phenyl-3-thiophen-2-ylpropane-1,2-diol.
| Compound Name | 1-phenyl-3-thiophen-2-ylpropane-1,2-diol |
|---|---|
| PubChem CID | 103459541 |
| Molecular Formula | C13H14O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-phenyl-3-thiophen-2-ylpropane-1,2-diol |
| SMILES | OC(Cc1cccs1)C(O)c1ccccc1 |
| InChI | InChI=1S/C13H14O2S/c14-12(9-11-7-4-8-16-11)13(15)10-5-2-1-3-6-10/h1-8,12-15H,9H2 |
| InChIKey | NCWCKEGJKXJBFS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |