C19H19NS — CID 43079612
1,2-diphenyl-N-(thiophen-2-ylmethyl)ethanamine (PubChem CID 43079612) has the molecular formula C19H19NS and a molecular weight of 293.44 g/mol. Its IUPAC name is 1,2-diphenyl-N-(thiophen-2-ylmethyl)ethanamine.
| Compound Name | 1,2-diphenyl-N-(thiophen-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 43079612 |
| Molecular Formula | C19H19NS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1,2-diphenyl-N-(thiophen-2-ylmethyl)ethanamine |
| SMILES | c1ccc(CC(NCc2cccs2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19NS/c1-3-8-16(9-4-1)14-19(17-10-5-2-6-11-17)20-15-18-12-7-13-21-18/h1-13,19-20H,14-15H2 |
| InChIKey | OUIZJOGJBDIRFN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |