C22H20N2S — CID 26629588
(1S)-N-(1,3-benzothiazol-2-ylmethyl)-1,2-diphenylethanamine (PubChem CID 26629588) has the molecular formula C22H20N2S and a molecular weight of 344.48 g/mol. Its IUPAC name is (1S)-N-(1,3-benzothiazol-2-ylmethyl)-1,2-diphenylethanamine.
| Compound Name | (1S)-N-(1,3-benzothiazol-2-ylmethyl)-1,2-diphenylethanamine |
|---|---|
| PubChem CID | 26629588 |
| Molecular Formula | C22H20N2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (1S)-N-(1,3-benzothiazol-2-ylmethyl)-1,2-diphenylethanamine |
| SMILES | c1ccc(C[C@H](NCc2nc3ccccc3s2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N2S/c1-3-9-17(10-4-1)15-20(18-11-5-2-6-12-18)23-16-22-24-19-13-7-8-14-21(19)25-22/h1-14,20,23H,15-16H2/t20-/m0/s1 |
| InChIKey | UEKNHGYMIZEDDO-FQEVSTJZSA-N |
| XLogP | 5.37 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |