C17H18N2OS — CID 63261117
2-(1,3-benzothiazol-2-ylmethylamino)-3-phenylpropan-1-ol (PubChem CID 63261117) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethylamino)-3-phenylpropan-1-ol.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethylamino)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 63261117 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethylamino)-3-phenylpropan-1-ol |
| SMILES | OCC(Cc1ccccc1)NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H18N2OS/c20-12-14(10-13-6-2-1-3-7-13)18-11-17-19-15-8-4-5-9-16(15)21-17/h1-9,14,18,20H,10-12H2 |
| InChIKey | XHGPGQFRJMYLCU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |