C20H21NO2 — CID 8621990
(1R,2R)-1-phenyl-2-[(5-phenylfuran-2-yl)methylamino]propan-1-ol (PubChem CID 8621990) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (1R,2R)-1-phenyl-2-[(5-phenylfuran-2-yl)methylamino]propan-1-ol.
| Compound Name | (1R,2R)-1-phenyl-2-[(5-phenylfuran-2-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 8621990 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (1R,2R)-1-phenyl-2-[(5-phenylfuran-2-yl)methylamino]propan-1-ol |
| SMILES | C[C@@H](NCc1ccc(-c2ccccc2)o1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H21NO2/c1-15(20(22)17-10-6-3-7-11-17)21-14-18-12-13-19(23-18)16-8-4-2-5-9-16/h2-13,15,20-22H,14H2,1H3/t15-,20+/m1/s1 |
| InChIKey | PZQNNDCAUSTISI-QRWLVFNGSA-N |
| XLogP | 4.16 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |