C20H21Cl2NO2 — CID 17332091
2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-1-phenylpropan-1-ol;hydrochloride (PubChem CID 17332091) has the molecular formula C20H21Cl2NO2 and a molecular weight of 378.30 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-1-phenylpropan-1-ol;hydrochloride.
| Compound Name | 2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-1-phenylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17332091 |
| Molecular Formula | C20H21Cl2NO2 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-1-phenylpropan-1-ol;hydrochloride |
| SMILES | CC(NCc1ccc(-c2ccc(Cl)cc2)o1)C(O)c1ccccc1.Cl |
| InChI | InChI=1S/C20H20ClNO2.ClH/c1-14(20(23)16-5-3-2-4-6-16)22-13-18-11-12-19(24-18)15-7-9-17(21)10-8-15;/h2-12,14,20,22-23H,13H2,1H3;1H |
| InChIKey | AKMNMFOTPZMKNT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |