C19H18ClNO — CID 8622797
(1R)-N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-1-phenylethanamine (PubChem CID 8622797) has the molecular formula C19H18ClNO and a molecular weight of 311.81 g/mol. Its IUPAC name is (1R)-N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-1-phenylethanamine.
| Compound Name | (1R)-N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 8622797 |
| Molecular Formula | C19H18ClNO |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (1R)-N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-1-phenylethanamine |
| SMILES | C[C@@H](NCc1ccc(-c2cccc(Cl)c2)o1)c1ccccc1 |
| InChI | InChI=1S/C19H18ClNO/c1-14(15-6-3-2-4-7-15)21-13-18-10-11-19(22-18)16-8-5-9-17(20)12-16/h2-12,14,21H,13H2,1H3/t14-/m1/s1 |
| InChIKey | JFQCCEHEJLUUFD-CQSZACIVSA-N |
| XLogP | 5.45 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |