C21H21NO3 — CID 8636505
methyl 4-[5-[[[(1R)-1-phenylethyl]amino]methyl]furan-2-yl]benzoate (PubChem CID 8636505) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is methyl 4-[5-[[[(1R)-1-phenylethyl]amino]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[[[(1R)-1-phenylethyl]amino]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 8636505 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | methyl 4-[5-[[[(1R)-1-phenylethyl]amino]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(CN[C@H](C)c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-15(16-6-4-3-5-7-16)22-14-19-12-13-20(25-19)17-8-10-18(11-9-17)21(23)24-2/h3-13,15,22H,14H2,1-2H3/t15-/m1/s1 |
| InChIKey | OPDHHCWBHYXYCA-OAHLLOKOSA-N |
| XLogP | 4.58 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |