C12H20N2O — CID 115726401
N-(1,2-oxazol-3-ylmethyl)oct-7-en-4-amine (PubChem CID 115726401) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is N-(1,2-oxazol-3-ylmethyl)oct-7-en-4-amine.
| Compound Name | N-(1,2-oxazol-3-ylmethyl)oct-7-en-4-amine |
|---|---|
| PubChem CID | 115726401 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-(1,2-oxazol-3-ylmethyl)oct-7-en-4-amine |
| SMILES | C=CCCC(CCC)NCc1ccon1 |
| InChI | InChI=1S/C12H20N2O/c1-3-5-7-11(6-4-2)13-10-12-8-9-15-14-12/h3,8-9,11,13H,1,4-7,10H2,2H3 |
| InChIKey | WMSHPAAUXPLRIS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|