C11H18N2O3 — CID 79502591
ethyl 2-(1,2-oxazol-3-ylmethylamino)pentanoate (PubChem CID 79502591) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is ethyl 2-(1,2-oxazol-3-ylmethylamino)pentanoate.
| Compound Name | ethyl 2-(1,2-oxazol-3-ylmethylamino)pentanoate |
|---|---|
| PubChem CID | 79502591 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | ethyl 2-(1,2-oxazol-3-ylmethylamino)pentanoate |
| SMILES | CCCC(NCc1ccon1)C(=O)OCC |
| InChI | InChI=1S/C11H18N2O3/c1-3-5-10(11(14)15-4-2)12-8-9-6-7-16-13-9/h6-7,10,12H,3-5,8H2,1-2H3 |
| InChIKey | QKGPBRGFCLGEHX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |