C10H17N3O2 — CID 81177101
2-(1,2-oxazol-3-ylmethylamino)-N-propan-2-ylpropanamide (PubChem CID 81177101) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-(1,2-oxazol-3-ylmethylamino)-N-propan-2-ylpropanamide.
| Compound Name | 2-(1,2-oxazol-3-ylmethylamino)-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 81177101 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-(1,2-oxazol-3-ylmethylamino)-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(C)NCc1ccon1 |
| InChI | InChI=1S/C10H17N3O2/c1-7(2)12-10(14)8(3)11-6-9-4-5-15-13-9/h4-5,7-8,11H,6H2,1-3H3,(H,12,14) |
| InChIKey | QTKKMRJVPOMGEB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |