C8H12N2O4 — CID 103259741
3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid (PubChem CID 103259741) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid.
| Compound Name | 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid |
|---|---|
| PubChem CID | 103259741 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid |
| SMILES | COCC(NCc1ccon1)C(=O)O |
| InChI | InChI=1S/C8H12N2O4/c1-13-5-7(8(11)12)9-4-6-2-3-14-10-6/h2-3,7,9H,4-5H2,1H3,(H,11,12) |
| InChIKey | JDFJIOUOARHNPZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |