3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid

C8H12N2O4 — CID 103259741

IUPAC3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid
SMILESCOCC(NCc1ccon1)C(=O)O
InChIInChI=1S/C8H12N2O4/c1-13-5-7(8(11)12)9-4-6-2-3-14-10-6/h2-3,7,9H,4-5H2,1H3,(H,11,12)
InChIKeyJDFJIOUOARHNPZ-UHFFFAOYSA-N
MW200.19 g/mol
LogP-0.14
Rot. Bonds6

About 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid

3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid (PubChem CID 103259741) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid.

Molecular Properties

Compound Name3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid
PubChem CID103259741
Molecular FormulaC8H12N2O4
Molecular Weight200.19 g/mol
Exact Mass200.08
IUPAC Name3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid
SMILESCOCC(NCc1ccon1)C(=O)O
InChIInChI=1S/C8H12N2O4/c1-13-5-7(8(11)12)9-4-6-2-3-14-10-6/h2-3,7,9H,4-5H2,1H3,(H,11,12)
InChIKeyJDFJIOUOARHNPZ-UHFFFAOYSA-N
XLogP-0.14
TPSA84.59 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.19
LogP ≤ 5-0.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid?
The IUPAC name of 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid (CID 103259741) is 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid.
What is the SMILES notation for 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid?
The canonical SMILES for 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid is COCC(NCc1ccon1)C(=O)O.
What is the InChIKey of 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid?
The InChIKey is JDFJIOUOARHNPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4/c1-13-5-7(8(11)12)9-4-6-2-3-14-10-6/h2-3,7,9H,4-5H2,1H3,(H,11,12).
What are the key properties of 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid?
3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid has a molecular weight of 200.19 g/mol, XLogP of -0.14, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-(1,2-oxazol-3-ylmethylamino)propanoic acid is sourced from PubChem (CID 103259741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).