C8H13N3O3 — CID 106113222
3-amino-2-methoxy-N-(1,2-oxazol-3-ylmethyl)propanamide (PubChem CID 106113222) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-amino-2-methoxy-N-(1,2-oxazol-3-ylmethyl)propanamide.
| Compound Name | 3-amino-2-methoxy-N-(1,2-oxazol-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 106113222 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3-amino-2-methoxy-N-(1,2-oxazol-3-ylmethyl)propanamide |
| SMILES | COC(CN)C(=O)NCc1ccon1 |
| InChI | InChI=1S/C8H13N3O3/c1-13-7(4-9)8(12)10-5-6-2-3-14-11-6/h2-3,7H,4-5,9H2,1H3,(H,10,12) |
| InChIKey | LKFQBXTWIHFYAO-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |