C9H13N3O4 — CID 79493406
ethyl 2-(1,2-oxazol-3-ylmethylcarbamoylamino)acetate (PubChem CID 79493406) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is ethyl 2-(1,2-oxazol-3-ylmethylcarbamoylamino)acetate.
| Compound Name | ethyl 2-(1,2-oxazol-3-ylmethylcarbamoylamino)acetate |
|---|---|
| PubChem CID | 79493406 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | ethyl 2-(1,2-oxazol-3-ylmethylcarbamoylamino)acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1ccon1 |
| InChI | InChI=1S/C9H13N3O4/c1-2-15-8(13)6-11-9(14)10-5-7-3-4-16-12-7/h3-4H,2,5-6H2,1H3,(H2,10,11,14) |
| InChIKey | MYDNNWHERBLYOF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |