C9H14N2O3 — CID 115353525
methyl 2-(1,2-oxazol-3-ylmethylamino)butanoate (PubChem CID 115353525) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl 2-(1,2-oxazol-3-ylmethylamino)butanoate.
| Compound Name | methyl 2-(1,2-oxazol-3-ylmethylamino)butanoate |
|---|---|
| PubChem CID | 115353525 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | methyl 2-(1,2-oxazol-3-ylmethylamino)butanoate |
| SMILES | CCC(NCc1ccon1)C(=O)OC |
| InChI | InChI=1S/C9H14N2O3/c1-3-8(9(12)13-2)10-6-7-4-5-14-11-7/h4-5,8,10H,3,6H2,1-2H3 |
| InChIKey | KGBPAIXVFJPWGA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |