C10H17N3O2 — CID 71866136
(2S)-3,3-dimethyl-2-(1,2-oxazol-3-ylmethylamino)butanamide (PubChem CID 71866136) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-(1,2-oxazol-3-ylmethylamino)butanamide.
| Compound Name | (2S)-3,3-dimethyl-2-(1,2-oxazol-3-ylmethylamino)butanamide |
|---|---|
| PubChem CID | 71866136 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | (2S)-3,3-dimethyl-2-(1,2-oxazol-3-ylmethylamino)butanamide |
| SMILES | CC(C)(C)[C@H](NCc1ccon1)C(N)=O |
| InChI | InChI=1S/C10H17N3O2/c1-10(2,3)8(9(11)14)12-6-7-4-5-15-13-7/h4-5,8,12H,6H2,1-3H3,(H2,11,14)/t8-/m1/s1 |
| InChIKey | MCOWRCKIXWTTMQ-MRVPVSSYSA-N |
| XLogP | 0.66 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |