C11H10N2O3 — CID 81178228
4-(1,2-oxazol-3-ylmethylamino)benzoic acid (PubChem CID 81178228) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 4-(1,2-oxazol-3-ylmethylamino)benzoic acid.
| Compound Name | 4-(1,2-oxazol-3-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 81178228 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 4-(1,2-oxazol-3-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NCc2ccon2)cc1 |
| InChI | InChI=1S/C11H10N2O3/c14-11(15)8-1-3-9(4-2-8)12-7-10-5-6-16-13-10/h1-6,12H,7H2,(H,14,15) |
| InChIKey | DKFDWCHRYTWFFZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |