4-(1,2-oxazol-3-ylmethylamino)benzoic acid

C11H10N2O3 — CID 81178228

IUPAC4-(1,2-oxazol-3-ylmethylamino)benzoic acid
SMILESO=C(O)c1ccc(NCc2ccon2)cc1
InChIInChI=1S/C11H10N2O3/c14-11(15)8-1-3-9(4-2-8)12-7-10-5-6-16-13-10/h1-6,12H,7H2,(H,14,15)
InChIKeyDKFDWCHRYTWFFZ-UHFFFAOYSA-N
MW218.21 g/mol
LogP1.98
Rot. Bonds4

About 4-(1,2-oxazol-3-ylmethylamino)benzoic acid

4-(1,2-oxazol-3-ylmethylamino)benzoic acid (PubChem CID 81178228) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 4-(1,2-oxazol-3-ylmethylamino)benzoic acid.

Molecular Properties

Compound Name4-(1,2-oxazol-3-ylmethylamino)benzoic acid
PubChem CID81178228
Molecular FormulaC11H10N2O3
Molecular Weight218.21 g/mol
Exact Mass218.07
IUPAC Name4-(1,2-oxazol-3-ylmethylamino)benzoic acid
SMILESO=C(O)c1ccc(NCc2ccon2)cc1
InChIInChI=1S/C11H10N2O3/c14-11(15)8-1-3-9(4-2-8)12-7-10-5-6-16-13-10/h1-6,12H,7H2,(H,14,15)
InChIKeyDKFDWCHRYTWFFZ-UHFFFAOYSA-N
XLogP1.98
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.21
LogP ≤ 51.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-(1,2-oxazol-3-ylmethylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,2-oxazol-3-ylmethylamino)benzoic acid?
The IUPAC name of 4-(1,2-oxazol-3-ylmethylamino)benzoic acid (CID 81178228) is 4-(1,2-oxazol-3-ylmethylamino)benzoic acid.
What is the SMILES notation for 4-(1,2-oxazol-3-ylmethylamino)benzoic acid?
The canonical SMILES for 4-(1,2-oxazol-3-ylmethylamino)benzoic acid is O=C(O)c1ccc(NCc2ccon2)cc1.
What is the InChIKey of 4-(1,2-oxazol-3-ylmethylamino)benzoic acid?
The InChIKey is DKFDWCHRYTWFFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O3/c14-11(15)8-1-3-9(4-2-8)12-7-10-5-6-16-13-10/h1-6,12H,7H2,(H,14,15).
What are the key properties of 4-(1,2-oxazol-3-ylmethylamino)benzoic acid?
4-(1,2-oxazol-3-ylmethylamino)benzoic acid has a molecular weight of 218.21 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-oxazol-3-ylmethylamino)benzoic acid is sourced from PubChem (CID 81178228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).