C16H19N3O3 — CID 71973649
N-(oxan-4-yl)-4-(1,2-oxazol-3-ylmethylamino)benzamide (PubChem CID 71973649) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(oxan-4-yl)-4-(1,2-oxazol-3-ylmethylamino)benzamide.
| Compound Name | N-(oxan-4-yl)-4-(1,2-oxazol-3-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 71973649 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-(oxan-4-yl)-4-(1,2-oxazol-3-ylmethylamino)benzamide |
| SMILES | O=C(NC1CCOCC1)c1ccc(NCc2ccon2)cc1 |
| InChI | InChI=1S/C16H19N3O3/c20-16(18-14-5-8-21-9-6-14)12-1-3-13(4-2-12)17-11-15-7-10-22-19-15/h1-4,7,10,14,17H,5-6,8-9,11H2,(H,18,20) |
| InChIKey | WLQACTKVRYGNQA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |