C11H17N3O3 — CID 81178209
N-(oxan-4-yl)-2-(1,2-oxazol-3-ylmethylamino)acetamide (PubChem CID 81178209) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-(oxan-4-yl)-2-(1,2-oxazol-3-ylmethylamino)acetamide.
| Compound Name | N-(oxan-4-yl)-2-(1,2-oxazol-3-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 81178209 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-(oxan-4-yl)-2-(1,2-oxazol-3-ylmethylamino)acetamide |
| SMILES | O=C(CNCc1ccon1)NC1CCOCC1 |
| InChI | InChI=1S/C11H17N3O3/c15-11(13-9-1-4-16-5-2-9)8-12-7-10-3-6-17-14-10/h3,6,9,12H,1-2,4-5,7-8H2,(H,13,15) |
| InChIKey | PAWZKDMTRSUVEJ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |