C13H21N3O2 — CID 81177432
N-cycloheptyl-2-(1,2-oxazol-3-ylmethylamino)acetamide (PubChem CID 81177432) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-cycloheptyl-2-(1,2-oxazol-3-ylmethylamino)acetamide.
| Compound Name | N-cycloheptyl-2-(1,2-oxazol-3-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 81177432 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | N-cycloheptyl-2-(1,2-oxazol-3-ylmethylamino)acetamide |
| SMILES | O=C(CNCc1ccon1)NC1CCCCCC1 |
| InChI | InChI=1S/C13H21N3O2/c17-13(10-14-9-12-7-8-18-16-12)15-11-5-3-1-2-4-6-11/h7-8,11,14H,1-6,9-10H2,(H,15,17) |
| InChIKey | SZNAFPRTZIJLEK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |