C10H15N3OS — CID 115704568
1-cyclopentyl-3-(1,2-oxazol-3-ylmethyl)thiourea (PubChem CID 115704568) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is 1-cyclopentyl-3-(1,2-oxazol-3-ylmethyl)thiourea.
| Compound Name | 1-cyclopentyl-3-(1,2-oxazol-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 115704568 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 1-cyclopentyl-3-(1,2-oxazol-3-ylmethyl)thiourea |
| SMILES | S=C(NCc1ccon1)NC1CCCC1 |
| InChI | InChI=1S/C10H15N3OS/c15-10(12-8-3-1-2-4-8)11-7-9-5-6-14-13-9/h5-6,8H,1-4,7H2,(H2,11,12,15) |
| InChIKey | MEMXXSJLQAHDEU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|