3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid

C10H9N3O3 — CID 114288825

IUPAC3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid
SMILESO=C(O)c1ccncc1NCc1ccon1
InChIInChI=1S/C10H9N3O3/c14-10(15)8-1-3-11-6-9(8)12-5-7-2-4-16-13-7/h1-4,6,12H,5H2,(H,14,15)
InChIKeyGPLWYTUUYCNBLM-UHFFFAOYSA-N
MW219.20 g/mol
LogP1.38
Rot. Bonds4

About 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid

3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid (PubChem CID 114288825) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid.

Molecular Properties

Compound Name3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid
PubChem CID114288825
Molecular FormulaC10H9N3O3
Molecular Weight219.20 g/mol
Exact Mass219.06
IUPAC Name3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid
SMILESO=C(O)c1ccncc1NCc1ccon1
InChIInChI=1S/C10H9N3O3/c14-10(15)8-1-3-11-6-9(8)12-5-7-2-4-16-13-7/h1-4,6,12H,5H2,(H,14,15)
InChIKeyGPLWYTUUYCNBLM-UHFFFAOYSA-N
XLogP1.38
TPSA88.25 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.20
LogP ≤ 51.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid?
The IUPAC name of 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid (CID 114288825) is 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid.
What is the SMILES notation for 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid?
The canonical SMILES for 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid is O=C(O)c1ccncc1NCc1ccon1.
What is the InChIKey of 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid?
The InChIKey is GPLWYTUUYCNBLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O3/c14-10(15)8-1-3-11-6-9(8)12-5-7-2-4-16-13-7/h1-4,6,12H,5H2,(H,14,15).
What are the key properties of 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid?
3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid has a molecular weight of 219.20 g/mol, XLogP of 1.38, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid is sourced from PubChem (CID 114288825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).