C10H9N3O3 — CID 114288825
3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid (PubChem CID 114288825) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid.
| Compound Name | 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114288825 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 3-(1,2-oxazol-3-ylmethylamino)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccncc1NCc1ccon1 |
| InChI | InChI=1S/C10H9N3O3/c14-10(15)8-1-3-11-6-9(8)12-5-7-2-4-16-13-7/h1-4,6,12H,5H2,(H,14,15) |
| InChIKey | GPLWYTUUYCNBLM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |