C10H13N3O3 — CID 105062601
3-[[2-(ethylamino)-2-oxoethyl]amino]pyridine-4-carboxylic acid (PubChem CID 105062601) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 3-[[2-(ethylamino)-2-oxoethyl]amino]pyridine-4-carboxylic acid.
| Compound Name | 3-[[2-(ethylamino)-2-oxoethyl]amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 105062601 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-[[2-(ethylamino)-2-oxoethyl]amino]pyridine-4-carboxylic acid |
| SMILES | CCNC(=O)CNc1cnccc1C(=O)O |
| InChI | InChI=1S/C10H13N3O3/c1-2-12-9(14)6-13-8-5-11-4-3-7(8)10(15)16/h3-5,13H,2,6H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | POUMBUNLGFXVJK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |