6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid

C11H11N3O3 — CID 81177066

IUPAC6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid
SMILESO=C(O)c1ccc(CNCc2ccon2)nc1
InChIInChI=1S/C11H11N3O3/c15-11(16)8-1-2-9(13-5-8)6-12-7-10-3-4-17-14-10/h1-5,12H,6-7H2,(H,15,16)
InChIKeyUTVQBKGATPZCRD-UHFFFAOYSA-N
MW233.23 g/mol
LogP1.06
Rot. Bonds5

About 6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid

6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid (PubChem CID 81177066) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid
PubChem CID81177066
Molecular FormulaC11H11N3O3
Molecular Weight233.23 g/mol
Exact Mass233.08
IUPAC Name6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid
SMILESO=C(O)c1ccc(CNCc2ccon2)nc1
InChIInChI=1S/C11H11N3O3/c15-11(16)8-1-2-9(13-5-8)6-12-7-10-3-4-17-14-10/h1-5,12H,6-7H2,(H,15,16)
InChIKeyUTVQBKGATPZCRD-UHFFFAOYSA-N
XLogP1.06
TPSA88.25 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.23
LogP ≤ 51.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid?
The IUPAC name of 6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid (CID 81177066) is 6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid.
What is the SMILES notation for 6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid?
The canonical SMILES for 6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid is O=C(O)c1ccc(CNCc2ccon2)nc1.
What is the InChIKey of 6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid?
The InChIKey is UTVQBKGATPZCRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3/c15-11(16)8-1-2-9(13-5-8)6-12-7-10-3-4-17-14-10/h1-5,12H,6-7H2,(H,15,16).
What are the key properties of 6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid?
6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid has a molecular weight of 233.23 g/mol, XLogP of 1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1,2-oxazol-3-ylmethylamino)methyl]pyridine-3-carboxylic acid is sourced from PubChem (CID 81177066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).