C12H17N3O4 — CID 113405119
6-[[[2-(2-methoxyethylamino)-2-oxoethyl]amino]methyl]pyridine-3-carboxylic acid (PubChem CID 113405119) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 6-[[[2-(2-methoxyethylamino)-2-oxoethyl]amino]methyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[[[2-(2-methoxyethylamino)-2-oxoethyl]amino]methyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 113405119 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 6-[[[2-(2-methoxyethylamino)-2-oxoethyl]amino]methyl]pyridine-3-carboxylic acid |
| SMILES | COCCNC(=O)CNCc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C12H17N3O4/c1-19-5-4-14-11(16)8-13-7-10-3-2-9(6-15-10)12(17)18/h2-3,6,13H,4-5,7-8H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | MOYVVLUFVYEBFP-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|