About 6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide
6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide (PubChem CID 158651359) has the molecular formula C8H9NO4S
and a molecular weight of 215.23 g/mol. Its IUPAC name is 6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide.
Molecular Properties
| Compound Name | 6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide |
| PubChem CID | 158651359 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide |
| SMILES | COCc1ccc(C(=O)O)cn1.O=S |
| InChI | InChI=1S/C8H9NO3.OS/c1-12-5-7-3-2-6(4-9-7)8(10)11;1-2/h2-4H,5H2,1H3,(H,10,11); |
| InChIKey | IBPFDCCYRBRWGG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide?
The IUPAC name of 6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide (CID 158651359) is 6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide.
What is the SMILES notation for 6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide?
The canonical SMILES for 6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide is COCc1ccc(C(=O)O)cn1.O=S.
What is the InChIKey of 6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide?
The InChIKey is IBPFDCCYRBRWGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3.OS/c1-12-5-7-3-2-6(4-9-7)8(10)11;1-2/h2-4H,5H2,1H3,(H,10,11);.
What are the key properties of 6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide?
6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide has a molecular weight of 215.23 g/mol, XLogP of 0.59, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methoxymethyl)pyridine-3-carboxylic acid;sulfur monoxide is sourced from PubChem (CID 158651359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).