C9H8N2O4 — CID 81177327
5-(1,2-oxazol-3-ylmethylamino)furan-2-carboxylic acid (PubChem CID 81177327) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 5-(1,2-oxazol-3-ylmethylamino)furan-2-carboxylic acid.
| Compound Name | 5-(1,2-oxazol-3-ylmethylamino)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 81177327 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 5-(1,2-oxazol-3-ylmethylamino)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(NCc2ccon2)o1 |
| InChI | InChI=1S/C9H8N2O4/c12-9(13)7-1-2-8(15-7)10-5-6-3-4-14-11-6/h1-4,10H,5H2,(H,12,13) |
| InChIKey | RYKLYHKADOITTL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |