About 5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid
5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 115424938) has the molecular formula C9H9N3O3S
and a molecular weight of 239.26 g/mol. Its IUPAC name is 5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 115424938 |
| Molecular Formula | C9H9N3O3S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1sc(NCc2ccon2)nc1C(=O)O |
| InChI | InChI=1S/C9H9N3O3S/c1-5-7(8(13)14)11-9(16-5)10-4-6-2-3-15-12-6/h2-3H,4H2,1H3,(H,10,11)(H,13,14) |
| InChIKey | PDIYGZVNPCCNFF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid (CID 115424938) is 5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid is Cc1sc(NCc2ccon2)nc1C(=O)O.
What is the InChIKey of 5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid?
The InChIKey is PDIYGZVNPCCNFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3S/c1-5-7(8(13)14)11-9(16-5)10-4-6-2-3-15-12-6/h2-3H,4H2,1H3,(H,10,11)(H,13,14).
What are the key properties of 5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid?
5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid has a molecular weight of 239.26 g/mol, XLogP of 1.75, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(1,2-oxazol-3-ylmethylamino)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 115424938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).