C11H18N2O2S — CID 104589369
ethyl 2-(1,3-thiazol-5-ylmethylamino)pentanoate (PubChem CID 104589369) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is ethyl 2-(1,3-thiazol-5-ylmethylamino)pentanoate.
| Compound Name | ethyl 2-(1,3-thiazol-5-ylmethylamino)pentanoate |
|---|---|
| PubChem CID | 104589369 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | ethyl 2-(1,3-thiazol-5-ylmethylamino)pentanoate |
| SMILES | CCCC(NCc1cncs1)C(=O)OCC |
| InChI | InChI=1S/C11H18N2O2S/c1-3-5-10(11(14)15-4-2)13-7-9-6-12-8-16-9/h6,8,10,13H,3-5,7H2,1-2H3 |
| InChIKey | CYFUEQMJQDYSNV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |