C12H16N2O2 — CID 115726406
1-(5-ethylfuran-2-yl)-N-(1,2-oxazol-3-ylmethyl)ethanamine (PubChem CID 115726406) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-(5-ethylfuran-2-yl)-N-(1,2-oxazol-3-ylmethyl)ethanamine.
| Compound Name | 1-(5-ethylfuran-2-yl)-N-(1,2-oxazol-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115726406 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-(5-ethylfuran-2-yl)-N-(1,2-oxazol-3-ylmethyl)ethanamine |
| SMILES | CCc1ccc(C(C)NCc2ccon2)o1 |
| InChI | InChI=1S/C12H16N2O2/c1-3-11-4-5-12(16-11)9(2)13-8-10-6-7-15-14-10/h4-7,9,13H,3,8H2,1-2H3 |
| InChIKey | DLAIZELYBITAFQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |