C12H21NO — CID 115704790
N-[1-(5-ethylfuran-2-yl)ethyl]-2-methylpropan-1-amine (PubChem CID 115704790) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N-[1-(5-ethylfuran-2-yl)ethyl]-2-methylpropan-1-amine.
| Compound Name | N-[1-(5-ethylfuran-2-yl)ethyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 115704790 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-[1-(5-ethylfuran-2-yl)ethyl]-2-methylpropan-1-amine |
| SMILES | CCc1ccc(C(C)NCC(C)C)o1 |
| InChI | InChI=1S/C12H21NO/c1-5-11-6-7-12(14-11)10(4)13-8-9(2)3/h6-7,9-10,13H,5,8H2,1-4H3 |
| InChIKey | JJWLRMIDWKIMNN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |