C12H21NO — CID 62346389
1-(5-ethylfuran-2-yl)-N,3-dimethylbutan-1-amine (PubChem CID 62346389) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-(5-ethylfuran-2-yl)-N,3-dimethylbutan-1-amine.
| Compound Name | 1-(5-ethylfuran-2-yl)-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 62346389 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1-(5-ethylfuran-2-yl)-N,3-dimethylbutan-1-amine |
| SMILES | CCc1ccc(C(CC(C)C)NC)o1 |
| InChI | InChI=1S/C12H21NO/c1-5-10-6-7-12(14-10)11(13-4)8-9(2)3/h6-7,9,11,13H,5,8H2,1-4H3 |
| InChIKey | FQGCMXRYSUONLB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |