C10H16ClNO — CID 112709867
1-(5-chlorofuran-2-yl)-N,3-dimethylbutan-1-amine (PubChem CID 112709867) has the molecular formula C10H16ClNO and a molecular weight of 201.70 g/mol. Its IUPAC name is 1-(5-chlorofuran-2-yl)-N,3-dimethylbutan-1-amine.
| Compound Name | 1-(5-chlorofuran-2-yl)-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 112709867 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 1-(5-chlorofuran-2-yl)-N,3-dimethylbutan-1-amine |
| SMILES | CNC(CC(C)C)c1ccc(Cl)o1 |
| InChI | InChI=1S/C10H16ClNO/c1-7(2)6-8(12-3)9-4-5-10(11)13-9/h4-5,7-8,12H,6H2,1-3H3 |
| InChIKey | RTRZPMLXOVRDDF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |