C13H12BrClFNO — CID 106691787
2-(2-bromo-4-fluorophenyl)-1-(5-chlorofuran-2-yl)-N-methylethanamine (PubChem CID 106691787) has the molecular formula C13H12BrClFNO and a molecular weight of 332.60 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenyl)-1-(5-chlorofuran-2-yl)-N-methylethanamine.
| Compound Name | 2-(2-bromo-4-fluorophenyl)-1-(5-chlorofuran-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 106691787 |
| Molecular Formula | C13H12BrClFNO |
| Molecular Weight | 332.60 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 2-(2-bromo-4-fluorophenyl)-1-(5-chlorofuran-2-yl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(F)cc1Br)c1ccc(Cl)o1 |
| InChI | InChI=1S/C13H12BrClFNO/c1-17-11(12-4-5-13(15)18-12)6-8-2-3-9(16)7-10(8)14/h2-5,7,11,17H,6H2,1H3 |
| InChIKey | PSFFEKOMGGGNMQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |