C13H14BrFN2O — CID 105296699
[2-(2-bromo-4-fluorophenyl)-1-(5-methylfuran-2-yl)ethyl]hydrazine (PubChem CID 105296699) has the molecular formula C13H14BrFN2O and a molecular weight of 313.17 g/mol. Its IUPAC name is [2-(2-bromo-4-fluorophenyl)-1-(5-methylfuran-2-yl)ethyl]hydrazine.
| Compound Name | [2-(2-bromo-4-fluorophenyl)-1-(5-methylfuran-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105296699 |
| Molecular Formula | C13H14BrFN2O |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | [2-(2-bromo-4-fluorophenyl)-1-(5-methylfuran-2-yl)ethyl]hydrazine |
| SMILES | Cc1ccc(C(Cc2ccc(F)cc2Br)NN)o1 |
| InChI | InChI=1S/C13H14BrFN2O/c1-8-2-5-13(18-8)12(17-16)6-9-3-4-10(15)7-11(9)14/h2-5,7,12,17H,6,16H2,1H3 |
| InChIKey | MINFTQFNBNRQIB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|