C12H18BrFN2 — CID 105202997
[1-(2-bromo-4-fluorophenyl)-3,3-dimethylbutan-2-yl]hydrazine (PubChem CID 105202997) has the molecular formula C12H18BrFN2 and a molecular weight of 289.19 g/mol. Its IUPAC name is [1-(2-bromo-4-fluorophenyl)-3,3-dimethylbutan-2-yl]hydrazine.
| Compound Name | [1-(2-bromo-4-fluorophenyl)-3,3-dimethylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105202997 |
| Molecular Formula | C12H18BrFN2 |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | [1-(2-bromo-4-fluorophenyl)-3,3-dimethylbutan-2-yl]hydrazine |
| SMILES | CC(C)(C)C(Cc1ccc(F)cc1Br)NN |
| InChI | InChI=1S/C12H18BrFN2/c1-12(2,3)11(16-15)6-8-4-5-9(14)7-10(8)13/h4-5,7,11,16H,6,15H2,1-3H3 |
| InChIKey | YDLRWFJQDWXNAH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|