C12H16BrFO — CID 62605952
1-(2-bromo-4-fluorophenyl)-3,3-dimethylbutan-2-ol (PubChem CID 62605952) has the molecular formula C12H16BrFO and a molecular weight of 275.16 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-3,3-dimethylbutan-2-ol.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 62605952 |
| Molecular Formula | C12H16BrFO |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)C(O)Cc1ccc(F)cc1Br |
| InChI | InChI=1S/C12H16BrFO/c1-12(2,3)11(15)6-8-4-5-9(14)7-10(8)13/h4-5,7,11,15H,6H2,1-3H3 |
| InChIKey | KHBSJDDBMAMQTJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |