C15H20BrFO — CID 114967990
1-(2-bromo-4-fluorophenyl)-4,5,5-trimethylhexan-2-one (PubChem CID 114967990) has the molecular formula C15H20BrFO and a molecular weight of 315.23 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-4,5,5-trimethylhexan-2-one.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-4,5,5-trimethylhexan-2-one |
|---|---|
| PubChem CID | 114967990 |
| Molecular Formula | C15H20BrFO |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-4,5,5-trimethylhexan-2-one |
| SMILES | CC(CC(=O)Cc1ccc(F)cc1Br)C(C)(C)C |
| InChI | InChI=1S/C15H20BrFO/c1-10(15(2,3)4)7-13(18)8-11-5-6-12(17)9-14(11)16/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | JIWUWECNZUSDCG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |