C14H19BrFNO — CID 78965919
2-bromo-4-fluoro-N-(2,3,3-trimethylbutyl)benzamide (PubChem CID 78965919) has the molecular formula C14H19BrFNO and a molecular weight of 316.21 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N-(2,3,3-trimethylbutyl)benzamide.
| Compound Name | 2-bromo-4-fluoro-N-(2,3,3-trimethylbutyl)benzamide |
|---|---|
| PubChem CID | 78965919 |
| Molecular Formula | C14H19BrFNO |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-bromo-4-fluoro-N-(2,3,3-trimethylbutyl)benzamide |
| SMILES | CC(CNC(=O)c1ccc(F)cc1Br)C(C)(C)C |
| InChI | InChI=1S/C14H19BrFNO/c1-9(14(2,3)4)8-17-13(18)11-6-5-10(16)7-12(11)15/h5-7,9H,8H2,1-4H3,(H,17,18) |
| InChIKey | NYABAPXEPPNYGS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |