C15H19BrFNO3 — CID 65493880
(3S)-3-[[(2-bromo-4-fluorobenzoyl)amino]methyl]-5-methylhexanoic acid (PubChem CID 65493880) has the molecular formula C15H19BrFNO3 and a molecular weight of 360.22 g/mol. Its IUPAC name is (3S)-3-[[(2-bromo-4-fluorobenzoyl)amino]methyl]-5-methylhexanoic acid.
| Compound Name | (3S)-3-[[(2-bromo-4-fluorobenzoyl)amino]methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 65493880 |
| Molecular Formula | C15H19BrFNO3 |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | (3S)-3-[[(2-bromo-4-fluorobenzoyl)amino]methyl]-5-methylhexanoic acid |
| SMILES | CC(C)C[C@H](CNC(=O)c1ccc(F)cc1Br)CC(=O)O |
| InChI | InChI=1S/C15H19BrFNO3/c1-9(2)5-10(6-14(19)20)8-18-15(21)12-4-3-11(17)7-13(12)16/h3-4,7,9-10H,5-6,8H2,1-2H3,(H,18,21)(H,19,20)/t10-/m0/s1 |
| InChIKey | NMWLKZMJUFUKHF-JTQLQIEISA-N |
| XLogP | 3.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |