C15H19F2NO3 — CID 65492448
(3S)-3-[[(3,4-difluorobenzoyl)amino]methyl]-5-methylhexanoic acid (PubChem CID 65492448) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is (3S)-3-[[(3,4-difluorobenzoyl)amino]methyl]-5-methylhexanoic acid.
| Compound Name | (3S)-3-[[(3,4-difluorobenzoyl)amino]methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 65492448 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (3S)-3-[[(3,4-difluorobenzoyl)amino]methyl]-5-methylhexanoic acid |
| SMILES | CC(C)C[C@H](CNC(=O)c1ccc(F)c(F)c1)CC(=O)O |
| InChI | InChI=1S/C15H19F2NO3/c1-9(2)5-10(6-14(19)20)8-18-15(21)11-3-4-12(16)13(17)7-11/h3-4,7,9-10H,5-6,8H2,1-2H3,(H,18,21)(H,19,20)/t10-/m0/s1 |
| InChIKey | TYIYKVUHMJHPNQ-JTQLQIEISA-N |
| XLogP | 2.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |