C17H25NO3 — CID 65494092
(3S)-3-[[(3,4-dimethylbenzoyl)amino]methyl]-5-methylhexanoic acid (PubChem CID 65494092) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (3S)-3-[[(3,4-dimethylbenzoyl)amino]methyl]-5-methylhexanoic acid.
| Compound Name | (3S)-3-[[(3,4-dimethylbenzoyl)amino]methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 65494092 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (3S)-3-[[(3,4-dimethylbenzoyl)amino]methyl]-5-methylhexanoic acid |
| SMILES | Cc1ccc(C(=O)NC[C@H](CC(=O)O)CC(C)C)cc1C |
| InChI | InChI=1S/C17H25NO3/c1-11(2)7-14(9-16(19)20)10-18-17(21)15-6-5-12(3)13(4)8-15/h5-6,8,11,14H,7,9-10H2,1-4H3,(H,18,21)(H,19,20)/t14-/m0/s1 |
| InChIKey | GZGFXZAQKNPYEI-AWEZNQCLSA-N |
| XLogP | 3.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |