C10H11BrFNO3 — CID 66175984
2-bromo-N-(2,3-dihydroxypropyl)-4-fluorobenzamide (PubChem CID 66175984) has the molecular formula C10H11BrFNO3 and a molecular weight of 292.10 g/mol. Its IUPAC name is 2-bromo-N-(2,3-dihydroxypropyl)-4-fluorobenzamide.
| Compound Name | 2-bromo-N-(2,3-dihydroxypropyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 66175984 |
| Molecular Formula | C10H11BrFNO3 |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 2-bromo-N-(2,3-dihydroxypropyl)-4-fluorobenzamide |
| SMILES | O=C(NCC(O)CO)c1ccc(F)cc1Br |
| InChI | InChI=1S/C10H11BrFNO3/c11-9-3-6(12)1-2-8(9)10(16)13-4-7(15)5-14/h1-3,7,14-15H,4-5H2,(H,13,16) |
| InChIKey | XTCMOUVUCBLGOZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |